C23H23F6N5O3S2 — CID 90455044
N-[4-[2-oxo-2-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethyl]phenyl]-N-(2,2,2-trifluoroethyl)methanesulfonamide (PubChem CID 90455044) has the molecular formula C23H23F6N5O3S2 and a molecular weight of 595.59 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethyl]phenyl]-N-(2,2,2-trifluoroethyl)methanesulfonamide.
| Compound Name | N-[4-[2-oxo-2-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethyl]phenyl]-N-(2,2,2-trifluoroethyl)methanesulfonamide |
|---|---|
| PubChem CID | 90455044 |
| Molecular Formula | C23H23F6N5O3S2 |
| Molecular Weight | 595.59 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | N-[4-[2-oxo-2-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethyl]phenyl]-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(F)(F)F)c1ccc(CC(=O)N2CCN(c3ncnc4sc(CC(F)(F)F)cc34)CC2)cc1 |
| InChI | InChI=1S/C23H23F6N5O3S2/c1-39(36,37)34(13-23(27,28)29)16-4-2-15(3-5-16)10-19(35)32-6-8-33(9-7-32)20-18-11-17(12-22(24,25)26)38-21(18)31-14-30-20/h2-5,11,14H,6-10,12-13H2,1H3 |
| InChIKey | RHALIHHWIRKDCU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |