About spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene]
spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene] (PubChem CID 90455285) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene].
Analyze spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene]?
The IUPAC name of spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene] (CID 90455285) is spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene].
What is the SMILES notation for spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene]?
The canonical SMILES for spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene] is C1=CC2=C(C1)CCC21OCCO1.
What is the InChIKey of spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene]?
The InChIKey is KCFGVDKYNZKXHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-2-8-4-5-10(9(8)3-1)11-6-7-12-10/h1,3H,2,4-7H2.
What are the key properties of spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene]?
spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene] has a molecular weight of 164.20 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,3'-2,6-dihydro-1H-pentalene] is sourced from PubChem (CID 90455285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).