C12H22N6O5S — CID 90455556
N-[4-(2-methoxyethylamino)-4-oxobutyl]sulfonyl-4-(2H-tetrazol-5-yl)butanamide (PubChem CID 90455556) has the molecular formula C12H22N6O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[4-(2-methoxyethylamino)-4-oxobutyl]sulfonyl-4-(2H-tetrazol-5-yl)butanamide.
| Compound Name | N-[4-(2-methoxyethylamino)-4-oxobutyl]sulfonyl-4-(2H-tetrazol-5-yl)butanamide |
|---|---|
| PubChem CID | 90455556 |
| Molecular Formula | C12H22N6O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[4-(2-methoxyethylamino)-4-oxobutyl]sulfonyl-4-(2H-tetrazol-5-yl)butanamide |
| SMILES | COCCNC(=O)CCCS(=O)(=O)NC(=O)CCCc1nn[nH]n1 |
| InChI | InChI=1S/C12H22N6O5S/c1-23-8-7-13-11(19)6-3-9-24(21,22)16-12(20)5-2-4-10-14-17-18-15-10/h2-9H2,1H3,(H,13,19)(H,16,20)(H,14,15,17,18) |
| InChIKey | CKUVYAZSTHGSDL-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|