C17H28N2O6 — CID 90455587
5-[[4-(1-carboxypropylcarbamoyl)cyclohexyl]methylamino]-5-oxopentanoic acid (PubChem CID 90455587) has the molecular formula C17H28N2O6 and a molecular weight of 356.42 g/mol. Its IUPAC name is 5-[[4-(1-carboxypropylcarbamoyl)cyclohexyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-(1-carboxypropylcarbamoyl)cyclohexyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90455587 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 5-[[4-(1-carboxypropylcarbamoyl)cyclohexyl]methylamino]-5-oxopentanoic acid |
| SMILES | CCC(NC(=O)C1CCC(CNC(=O)CCCC(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C17H28N2O6/c1-2-13(17(24)25)19-16(23)12-8-6-11(7-9-12)10-18-14(20)4-3-5-15(21)22/h11-13H,2-10H2,1H3,(H,18,20)(H,19,23)(H,21,22)(H,24,25) |
| InChIKey | MPVHWKVGPZAVEW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |