C19H15Cl2N7O — CID 90455757
(7S)-5-(2,3-dichlorophenyl)-10-(4-methoxy-2-pyridinyl)-7-methyl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 90455757) has the molecular formula C19H15Cl2N7O and a molecular weight of 428.28 g/mol. Its IUPAC name is (7S)-5-(2,3-dichlorophenyl)-10-(4-methoxy-2-pyridinyl)-7-methyl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | (7S)-5-(2,3-dichlorophenyl)-10-(4-methoxy-2-pyridinyl)-7-methyl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 90455757 |
| Molecular Formula | C19H15Cl2N7O |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (7S)-5-(2,3-dichlorophenyl)-10-(4-methoxy-2-pyridinyl)-7-methyl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | COc1ccnc(-c2nnc3n2C[C@H](C)n2c(-c4cccc(Cl)c4Cl)nnc2-3)c1 |
| InChI | InChI=1S/C19H15Cl2N7O/c1-10-9-27-17(14-8-11(29-2)6-7-22-14)24-25-18(27)19-26-23-16(28(10)19)12-4-3-5-13(20)15(12)21/h3-8,10H,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | NPORTCNBJKXLES-JTQLQIEISA-N |
| XLogP | 4.16 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |