C19H13ClF3N7 — CID 90455880
(7S)-5-[2-chloro-3-(trifluoromethyl)phenyl]-7-methyl-10-pyridin-2-yl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 90455880) has the molecular formula C19H13ClF3N7 and a molecular weight of 431.81 g/mol. Its IUPAC name is (7S)-5-[2-chloro-3-(trifluoromethyl)phenyl]-7-methyl-10-pyridin-2-yl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | (7S)-5-[2-chloro-3-(trifluoromethyl)phenyl]-7-methyl-10-pyridin-2-yl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 90455880 |
| Molecular Formula | C19H13ClF3N7 |
| Molecular Weight | 431.81 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (7S)-5-[2-chloro-3-(trifluoromethyl)phenyl]-7-methyl-10-pyridin-2-yl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | C[C@H]1Cn2c(-c3ccccn3)nnc2-c2nnc(-c3cccc(C(F)(F)F)c3Cl)n21 |
| InChI | InChI=1S/C19H13ClF3N7/c1-10-9-29-16(13-7-2-3-8-24-13)26-27-17(29)18-28-25-15(30(10)18)11-5-4-6-12(14(11)20)19(21,22)23/h2-8,10H,9H2,1H3/t10-/m0/s1 |
| InChIKey | QAWWLDXHANLVNZ-JTQLQIEISA-N |
| XLogP | 4.51 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |