C16H25N3OSi — CID 90456078
tert-butyl-[(6-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methoxy]-dimethylsilane (PubChem CID 90456078) has the molecular formula C16H25N3OSi and a molecular weight of 303.48 g/mol. Its IUPAC name is tert-butyl-[(6-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(6-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 90456078 |
| Molecular Formula | C16H25N3OSi |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl-[(6-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc2nncn2cc1C1CC1 |
| InChI | InChI=1S/C16H25N3OSi/c1-16(2,3)21(4,5)20-10-13-8-15-18-17-11-19(15)9-14(13)12-6-7-12/h8-9,11-12H,6-7,10H2,1-5H3 |
| InChIKey | WTLUKGKGINLUDV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|