C16H14ClF3N6 — CID 90456146
(7S)-5-[2-chloro-3-(trifluoromethyl)phenyl]-10-ethyl-7-methyl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 90456146) has the molecular formula C16H14ClF3N6 and a molecular weight of 382.78 g/mol. Its IUPAC name is (7S)-5-[2-chloro-3-(trifluoromethyl)phenyl]-10-ethyl-7-methyl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | (7S)-5-[2-chloro-3-(trifluoromethyl)phenyl]-10-ethyl-7-methyl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 90456146 |
| Molecular Formula | C16H14ClF3N6 |
| Molecular Weight | 382.78 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (7S)-5-[2-chloro-3-(trifluoromethyl)phenyl]-10-ethyl-7-methyl-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | CCc1nnc2n1C[C@H](C)n1c(-c3cccc(C(F)(F)F)c3Cl)nnc1-2 |
| InChI | InChI=1S/C16H14ClF3N6/c1-3-11-21-23-14-15-24-22-13(26(15)8(2)7-25(11)14)9-5-4-6-10(12(9)17)16(18,19)20/h4-6,8H,3,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | YLCXRKKQOOOVJS-QMMMGPOBSA-N |
| XLogP | 4.01 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |