C20H27Cl3N8 — CID 90456696
2-N-[(3,4-dichlorophenyl)methyl]-6-N-methyl-4-N,8-N-dipropylpyrimido[5,4-d]pyrimidine-2,4,6,8-tetramine;hydrochloride (PubChem CID 90456696) has the molecular formula C20H27Cl3N8 and a molecular weight of 485.85 g/mol. Its IUPAC name is 2-N-[(3,4-dichlorophenyl)methyl]-6-N-methyl-4-N,8-N-dipropylpyrimido[5,4-d]pyrimidine-2,4,6,8-tetramine;hydrochloride.
| Compound Name | 2-N-[(3,4-dichlorophenyl)methyl]-6-N-methyl-4-N,8-N-dipropylpyrimido[5,4-d]pyrimidine-2,4,6,8-tetramine;hydrochloride |
|---|---|
| PubChem CID | 90456696 |
| Molecular Formula | C20H27Cl3N8 |
| Molecular Weight | 485.85 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-N-[(3,4-dichlorophenyl)methyl]-6-N-methyl-4-N,8-N-dipropylpyrimido[5,4-d]pyrimidine-2,4,6,8-tetramine;hydrochloride |
| SMILES | CCCNc1nc(NCc2ccc(Cl)c(Cl)c2)nc2c(NCCC)nc(NC)nc12.Cl |
| InChI | InChI=1S/C20H26Cl2N8.ClH/c1-4-8-24-17-16-15(27-19(23-3)29-17)18(25-9-5-2)30-20(28-16)26-11-12-6-7-13(21)14(22)10-12;/h6-7,10H,4-5,8-9,11H2,1-3H3,(H2,23,24,27,29)(H2,25,26,28,30);1H |
| InChIKey | AVOSXAJVOOQRJC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.85 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |