C10H11F3N2O4 — CID 90457005
1-(azetidin-1-ium-3-ylmethyl)pyrrole-2,5-dione;2,2,2-trifluoroacetate (PubChem CID 90457005) has the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. Its IUPAC name is 1-(azetidin-1-ium-3-ylmethyl)pyrrole-2,5-dione;2,2,2-trifluoroacetate.
| Compound Name | 1-(azetidin-1-ium-3-ylmethyl)pyrrole-2,5-dione;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90457005 |
| Molecular Formula | C10H11F3N2O4 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-(azetidin-1-ium-3-ylmethyl)pyrrole-2,5-dione;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.O=C1C=CC(=O)N1CC1C[NH2+]C1 |
| InChI | InChI=1S/C8H10N2O2.C2HF3O2/c11-7-1-2-8(12)10(7)5-6-3-9-4-6;3-2(4,5)1(6)7/h1-2,6,9H,3-5H2;(H,6,7) |
| InChIKey | ZYJTXRKOGFSXGL-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|