About 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine
4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine (PubChem CID 90457029) has the molecular formula C14H18BrFN2O3
and a molecular weight of 361.21 g/mol. Its IUPAC name is 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine.
Molecular Properties
| Compound Name | 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine |
| PubChem CID | 90457029 |
| Molecular Formula | C14H18BrFN2O3 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine |
| SMILES | F[C@@H]1COCC[C@@H]1Oc1ncc(Br)cc1N1CCOCC1 |
| InChI | InChI=1S/C14H18BrFN2O3/c15-10-7-12(18-2-5-19-6-3-18)14(17-8-10)21-13-1-4-20-9-11(13)16/h7-8,11,13H,1-6,9H2/t11-,13+/m1/s1 |
| InChIKey | VWFIXUSPBWMVFP-YPMHNXCESA-N |
| XLogP | 2.19 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine?
The IUPAC name of 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine (CID 90457029) is 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine.
What is the SMILES notation for 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine?
The canonical SMILES for 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine is F[C@@H]1COCC[C@@H]1Oc1ncc(Br)cc1N1CCOCC1.
What is the InChIKey of 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine?
The InChIKey is VWFIXUSPBWMVFP-YPMHNXCESA-N. The full InChI is InChI=1S/C14H18BrFN2O3/c15-10-7-12(18-2-5-19-6-3-18)14(17-8-10)21-13-1-4-20-9-11(13)16/h7-8,11,13H,1-6,9H2/t11-,13+/m1/s1.
What are the key properties of 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine?
4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine has a molecular weight of 361.21 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-bromo-2-[(3R,4S)-3-fluorooxan-4-yl]oxy-3-pyridinyl]morpholine is sourced from PubChem (CID 90457029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).