C15H26O5 — CID 90457345
butyl 7,9,9-trimethyl-1,4,8-trioxaspiro[4.5]decane-7-carboxylate (PubChem CID 90457345) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is butyl 7,9,9-trimethyl-1,4,8-trioxaspiro[4.5]decane-7-carboxylate.
| Compound Name | butyl 7,9,9-trimethyl-1,4,8-trioxaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 90457345 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | butyl 7,9,9-trimethyl-1,4,8-trioxaspiro[4.5]decane-7-carboxylate |
| SMILES | CCCCOC(=O)C1(C)CC2(CC(C)(C)O1)OCCO2 |
| InChI | InChI=1S/C15H26O5/c1-5-6-7-17-12(16)14(4)11-15(18-8-9-19-15)10-13(2,3)20-14/h5-11H2,1-4H3 |
| InChIKey | HORDVJSSEYTFCQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|