C23H33N5O3 — CID 90457709
(3S)-3-[4-[bis(2-methylpropyl)amino]-3-(pyrimidin-5-ylcarbamoylamino)phenyl]butanoic acid (PubChem CID 90457709) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is (3S)-3-[4-[bis(2-methylpropyl)amino]-3-(pyrimidin-5-ylcarbamoylamino)phenyl]butanoic acid.
| Compound Name | (3S)-3-[4-[bis(2-methylpropyl)amino]-3-(pyrimidin-5-ylcarbamoylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 90457709 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (3S)-3-[4-[bis(2-methylpropyl)amino]-3-(pyrimidin-5-ylcarbamoylamino)phenyl]butanoic acid |
| SMILES | CC(C)CN(CC(C)C)c1ccc([C@@H](C)CC(=O)O)cc1NC(=O)Nc1cncnc1 |
| InChI | InChI=1S/C23H33N5O3/c1-15(2)12-28(13-16(3)4)21-7-6-18(17(5)8-22(29)30)9-20(21)27-23(31)26-19-10-24-14-25-11-19/h6-7,9-11,14-17H,8,12-13H2,1-5H3,(H,29,30)(H2,26,27,31)/t17-/m0/s1 |
| InChIKey | LJCAFMSKDUEZRV-KRWDZBQOSA-N |
| XLogP | 4.82 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |