About N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine
N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine (PubChem CID 90458043) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 90458043 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine |
| SMILES | CCNC1=CCC(=CN2CCCC2)C=C1OC |
| InChI | InChI=1S/C14H22N2O/c1-3-15-13-7-6-12(10-14(13)17-2)11-16-8-4-5-9-16/h7,10-11,15H,3-6,8-9H2,1-2H3 |
| InChIKey | GEACTXRNONYRSK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine?
The IUPAC name of N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine (CID 90458043) is N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine is CCNC1=CCC(=CN2CCCC2)C=C1OC.
What is the InChIKey of N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine?
The InChIKey is GEACTXRNONYRSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-3-15-13-7-6-12(10-14(13)17-2)11-16-8-4-5-9-16/h7,10-11,15H,3-6,8-9H2,1-2H3.
What are the key properties of N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine?
N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine has a molecular weight of 234.34 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-methoxy-4-(pyrrolidin-1-ylmethylidene)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 90458043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).