C23H29N7O2 — CID 90458061
N-[5-ethoxy-2-[[6-methyl-5-(piperidin-3-ylamino)pyrazolo[1,5-a]pyrimidin-7-yl]amino]phenyl]prop-2-enamide (PubChem CID 90458061) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[5-ethoxy-2-[[6-methyl-5-(piperidin-3-ylamino)pyrazolo[1,5-a]pyrimidin-7-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[5-ethoxy-2-[[6-methyl-5-(piperidin-3-ylamino)pyrazolo[1,5-a]pyrimidin-7-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90458061 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-[5-ethoxy-2-[[6-methyl-5-(piperidin-3-ylamino)pyrazolo[1,5-a]pyrimidin-7-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(OCC)ccc1Nc1c(C)c(NC2CCCNC2)nc2ccnn12 |
| InChI | InChI=1S/C23H29N7O2/c1-4-21(31)27-19-13-17(32-5-2)8-9-18(19)28-23-15(3)22(26-16-7-6-11-24-14-16)29-20-10-12-25-30(20)23/h4,8-10,12-13,16,24,28H,1,5-7,11,14H2,2-3H3,(H,26,29)(H,27,31) |
| InChIKey | OARGAIXNYPDXML-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|