C21H29F3N2O2 — CID 90458489
2-[3-amino-4-[cyclohexyl-(4,4,4-trifluoro-2-methylbutyl)amino]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 90458489) has the molecular formula C21H29F3N2O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-[3-amino-4-[cyclohexyl-(4,4,4-trifluoro-2-methylbutyl)amino]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[3-amino-4-[cyclohexyl-(4,4,4-trifluoro-2-methylbutyl)amino]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 90458489 |
| Molecular Formula | C21H29F3N2O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-[3-amino-4-[cyclohexyl-(4,4,4-trifluoro-2-methylbutyl)amino]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(CN(c1ccc(C2CC2C(=O)O)cc1N)C1CCCCC1)CC(F)(F)F |
| InChI | InChI=1S/C21H29F3N2O2/c1-13(11-21(22,23)24)12-26(15-5-3-2-4-6-15)19-8-7-14(9-18(19)25)16-10-17(16)20(27)28/h7-9,13,15-17H,2-6,10-12,25H2,1H3,(H,27,28) |
| InChIKey | PQVVHIGSBCOJEB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|