About ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate
ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate (PubChem CID 90458607) has the molecular formula C20H27F3N2O4
and a molecular weight of 416.44 g/mol. Its IUPAC name is ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate |
| PubChem CID | 90458607 |
| Molecular Formula | C20H27F3N2O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(\c1ccc(N(CC(C)C)CC(C)C)c([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C20H27F3N2O4/c1-6-29-19(26)10-16(20(21,22)23)15-7-8-17(18(9-15)25(27)28)24(11-13(2)3)12-14(4)5/h7-10,13-14H,6,11-12H2,1-5H3/b16-10+ |
| InChIKey | AJWPOLLHJKHLTC-MHWRWJLKSA-N |
| XLogP | 5.22 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate?
The IUPAC name of ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate (CID 90458607) is ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate.
What is the SMILES notation for ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate?
The canonical SMILES for ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate is CCOC(=O)/C=C(\c1ccc(N(CC(C)C)CC(C)C)c([N+](=O)[O-])c1)C(F)(F)F.
What is the InChIKey of ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate?
The InChIKey is AJWPOLLHJKHLTC-MHWRWJLKSA-N. The full InChI is InChI=1S/C20H27F3N2O4/c1-6-29-19(26)10-16(20(21,22)23)15-7-8-17(18(9-15)25(27)28)24(11-13(2)3)12-14(4)5/h7-10,13-14H,6,11-12H2,1-5H3/b16-10+.
What are the key properties of ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate?
ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate has a molecular weight of 416.44 g/mol, XLogP of 5.22, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoate is sourced from PubChem (CID 90458607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).