C14H30O4 — CID 90460331
2-ethyl-2,5,7,7-tetramethyloctane-1,3,4,8-tetrol (PubChem CID 90460331) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-ethyl-2,5,7,7-tetramethyloctane-1,3,4,8-tetrol.
| Compound Name | 2-ethyl-2,5,7,7-tetramethyloctane-1,3,4,8-tetrol |
|---|---|
| PubChem CID | 90460331 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 2-ethyl-2,5,7,7-tetramethyloctane-1,3,4,8-tetrol |
| SMILES | CCC(C)(CO)C(O)C(O)C(C)CC(C)(C)CO |
| InChI | InChI=1S/C14H30O4/c1-6-14(5,9-16)12(18)11(17)10(2)7-13(3,4)8-15/h10-12,15-18H,6-9H2,1-5H3 |
| InChIKey | XBOACFHXVUUTLH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |