About 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde
3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde (PubChem CID 90460549) has the molecular formula C17H22N2O4
and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde |
| PubChem CID | 90460549 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn([C@H]2CCCCO2)nc1C1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C17H22N2O4/c20-12-14-11-19(15-3-1-2-8-21-15)18-16(14)13-4-6-17(7-5-13)22-9-10-23-17/h4,11-12,15H,1-3,5-10H2/t15-/m1/s1 |
| InChIKey | MKCFCQPAPQHHAJ-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde?
The IUPAC name of 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde (CID 90460549) is 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde.
What is the SMILES notation for 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde?
The canonical SMILES for 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde is O=Cc1cn([C@H]2CCCCO2)nc1C1=CCC2(CC1)OCCO2.
What is the InChIKey of 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde?
The InChIKey is MKCFCQPAPQHHAJ-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H22N2O4/c20-12-14-11-19(15-3-1-2-8-21-15)18-16(14)13-4-6-17(7-5-13)22-9-10-23-17/h4,11-12,15H,1-3,5-10H2/t15-/m1/s1.
What are the key properties of 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde?
3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde has a molecular weight of 318.37 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-[(2R)-oxan-2-yl]pyrazole-4-carbaldehyde is sourced from PubChem (CID 90460549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).