About (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine
(2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine (PubChem CID 90460659) has the molecular formula C15H17BrN2O
and a molecular weight of 321.22 g/mol. Its IUPAC name is (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine.
Molecular Properties
| Compound Name | (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine |
| PubChem CID | 90460659 |
| Molecular Formula | C15H17BrN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2ccc3cc(Br)ccc3n2)[C@H](C)CO1 |
| InChI | InChI=1S/C15H17BrN2O/c1-10-9-19-11(2)8-18(10)15-6-3-12-7-13(16)4-5-14(12)17-15/h3-7,10-11H,8-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | ZWMNTUFGLSQDFM-GHMZBOCLSA-N |
| XLogP | 3.61 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine?
The IUPAC name of (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine (CID 90460659) is (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine.
What is the SMILES notation for (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine?
The canonical SMILES for (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine is C[C@@H]1CN(c2ccc3cc(Br)ccc3n2)[C@H](C)CO1.
What is the InChIKey of (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine?
The InChIKey is ZWMNTUFGLSQDFM-GHMZBOCLSA-N. The full InChI is InChI=1S/C15H17BrN2O/c1-10-9-19-11(2)8-18(10)15-6-3-12-7-13(16)4-5-14(12)17-15/h3-7,10-11H,8-9H2,1-2H3/t10-,11-/m1/s1.
What are the key properties of (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine?
(2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine has a molecular weight of 321.22 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-4-(6-bromoquinolin-2-yl)-2,5-dimethylmorpholine is sourced from PubChem (CID 90460659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).