C22H35BN2O4 — CID 90460966
tert-butyl 4-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate (PubChem CID 90460966) has the molecular formula C22H35BN2O4 and a molecular weight of 402.34 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90460966 |
| Molecular Formula | C22H35BN2O4 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | tert-butyl 4-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2N)CC1 |
| InChI | InChI=1S/C22H35BN2O4/c1-20(2,3)27-19(26)25-12-10-15(11-13-25)17-9-8-16(14-18(17)24)23-28-21(4,5)22(6,7)29-23/h8-9,14-15H,10-13,24H2,1-7H3 |
| InChIKey | XUAFXFMNLKOFQC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|