About 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate
1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate (PubChem CID 90461291) has the molecular formula C20H34N3O4+
and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate |
| PubChem CID | 90461291 |
| Molecular Formula | C20H34N3O4+ |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1C[N+](CC)(C(=O)OC(C)(C)C)CC1c1ccnn1C(C)C |
| InChI | InChI=1S/C20H34N3O4/c1-8-23(19(25)27-20(5,6)7)12-15(16(13-23)18(24)26-9-2)17-10-11-21-22(17)14(3)4/h10-11,14-16H,8-9,12-13H2,1-7H3/q+1 |
| InChIKey | BHHKADFVHVTXQW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate (CID 90461291) is 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate is CCOC(=O)C1C[N+](CC)(C(=O)OC(C)(C)C)CC1c1ccnn1C(C)C.
What is the InChIKey of 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate?
The InChIKey is BHHKADFVHVTXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N3O4/c1-8-23(19(25)27-20(5,6)7)12-15(16(13-23)18(24)26-9-2)17-10-11-21-22(17)14(3)4/h10-11,14-16H,8-9,12-13H2,1-7H3/q+1.
What are the key properties of 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate?
1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate has a molecular weight of 380.51 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 3-O-ethyl 1-ethyl-4-(2-propan-2-ylpyrazol-3-yl)pyrrolidin-1-ium-1,3-dicarboxylate is sourced from PubChem (CID 90461291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).