C37H57BN4O9 — CID 90461330
tert-butyl 2-methoxy-3-[2-[[2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-oxopiperazin-1-yl]acetyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate (PubChem CID 90461330) has the molecular formula C37H57BN4O9 and a molecular weight of 712.69 g/mol. Its IUPAC name is tert-butyl 2-methoxy-3-[2-[[2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-oxopiperazin-1-yl]acetyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate.
| Compound Name | tert-butyl 2-methoxy-3-[2-[[2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-oxopiperazin-1-yl]acetyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 90461330 |
| Molecular Formula | C37H57BN4O9 |
| Molecular Weight | 712.69 g/mol |
| Exact Mass | 712.42 |
| IUPAC Name | tert-butyl 2-methoxy-3-[2-[[2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-oxopiperazin-1-yl]acetyl]amino]-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]benzoate |
| SMILES | COc1c(CC(NC(=O)CN2CCN(CCNC(=O)OC(C)(C)C)CC2=O)B2OC3CC4CC(C4(C)C)C3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H57BN4O9/c1-34(2,3)48-32(45)25-13-11-12-23(31(25)47-10)18-28(38-50-27-20-24-19-26(36(24,7)8)37(27,9)51-38)40-29(43)21-42-17-16-41(22-30(42)44)15-14-39-33(46)49-35(4,5)6/h11-13,24,26-28H,14-22H2,1-10H3,(H,39,46)(H,40,43) |
| InChIKey | JPRMSHOZWWHLIA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|