C17H29IN4O3 — CID 90461440
tert-butyl N-[2-[[3-iodo-1-[(2R)-oxan-2-yl]pyrazol-4-yl]methyl-methylamino]ethyl]carbamate (PubChem CID 90461440) has the molecular formula C17H29IN4O3 and a molecular weight of 464.35 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-iodo-1-[(2R)-oxan-2-yl]pyrazol-4-yl]methyl-methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-iodo-1-[(2R)-oxan-2-yl]pyrazol-4-yl]methyl-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 90461440 |
| Molecular Formula | C17H29IN4O3 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | tert-butyl N-[2-[[3-iodo-1-[(2R)-oxan-2-yl]pyrazol-4-yl]methyl-methylamino]ethyl]carbamate |
| SMILES | CN(CCNC(=O)OC(C)(C)C)Cc1cn([C@H]2CCCCO2)nc1I |
| InChI | InChI=1S/C17H29IN4O3/c1-17(2,3)25-16(23)19-8-9-21(4)11-13-12-22(20-15(13)18)14-7-5-6-10-24-14/h12,14H,5-11H2,1-4H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | GVQVMKJOHFYMLN-CQSZACIVSA-N |
| XLogP | 3.14 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|