C15H20N3OSi — CID 90461645
CID 90461645 (PubChem CID 90461645) has the molecular formula C15H20N3OSi and a molecular weight of 286.43 g/mol.
| Compound Name | CID 90461645 |
|---|---|
| PubChem CID | 90461645 |
| Molecular Formula | C15H20N3OSi |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | — |
| SMILES | Cc1ccc(/N=C/Cc2cnn(C)c2)c(O[Si](C)C)c1 |
| InChI | InChI=1S/C15H20N3OSi/c1-12-5-6-14(15(9-12)19-20(3)4)16-8-7-13-10-17-18(2)11-13/h5-6,8-11H,7H2,1-4H3/b16-8+ |
| InChIKey | NENXJYSRHTWXFQ-LZYBPNLTSA-N |
| XLogP | 3.30 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|