C9H11NO3 — CID 90461716
4-(dimethylamino)-2,6-dihydroxybenzaldehyde (PubChem CID 90461716) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-(dimethylamino)-2,6-dihydroxybenzaldehyde.
| Compound Name | 4-(dimethylamino)-2,6-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 90461716 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-(dimethylamino)-2,6-dihydroxybenzaldehyde |
| SMILES | CN(C)c1cc(O)c(C=O)c(O)c1 |
| InChI | InChI=1S/C9H11NO3/c1-10(2)6-3-8(12)7(5-11)9(13)4-6/h3-5,12-13H,1-2H3 |
| InChIKey | PXXRPKVZTOPQKF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|