About 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol
5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol (PubChem CID 90462059) has the molecular formula C10H8BrF3O
and a molecular weight of 281.07 g/mol. Its IUPAC name is 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol.
Molecular Properties
| Compound Name | 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol |
| PubChem CID | 90462059 |
| Molecular Formula | C10H8BrF3O |
| Molecular Weight | 281.07 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(C(F)(F)F)Cc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C10H8BrF3O/c11-8-2-1-6-4-9(15,10(12,13)14)5-7(6)3-8/h1-3,15H,4-5H2 |
| InChIKey | VFQUSGNLPZYLBS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.07 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol?
The IUPAC name of 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol (CID 90462059) is 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol.
What is the SMILES notation for 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol?
The canonical SMILES for 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol is OC1(C(F)(F)F)Cc2ccc(Br)cc2C1.
What is the InChIKey of 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol?
The InChIKey is VFQUSGNLPZYLBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF3O/c11-8-2-1-6-4-9(15,10(12,13)14)5-7(6)3-8/h1-3,15H,4-5H2.
What are the key properties of 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol?
5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol has a molecular weight of 281.07 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(trifluoromethyl)-1,3-dihydroinden-2-ol is sourced from PubChem (CID 90462059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).