C22H27FN2O4 — CID 90462639
2-[[2-(2-tert-butyl-4-fluorophenoxy)ethyl-methylcarbamoyl]amino]-3-methylbenzoic acid (PubChem CID 90462639) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[[2-(2-tert-butyl-4-fluorophenoxy)ethyl-methylcarbamoyl]amino]-3-methylbenzoic acid.
| Compound Name | 2-[[2-(2-tert-butyl-4-fluorophenoxy)ethyl-methylcarbamoyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 90462639 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-[[2-(2-tert-butyl-4-fluorophenoxy)ethyl-methylcarbamoyl]amino]-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1NC(=O)N(C)CCOc1ccc(F)cc1C(C)(C)C |
| InChI | InChI=1S/C22H27FN2O4/c1-14-7-6-8-16(20(26)27)19(14)24-21(28)25(5)11-12-29-18-10-9-15(23)13-17(18)22(2,3)4/h6-10,13H,11-12H2,1-5H3,(H,24,28)(H,26,27) |
| InChIKey | RILKFDNCTIOBAL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |