C28H37N12+ — CID 90463218
2-aminoethyl-bis[[5-(1H-indazol-4-yl)-1H-pyrazol-4-yl]methyl]-methylazanium;N'-methylethane-1,2-diamine (PubChem CID 90463218) has the molecular formula C28H37N12+ and a molecular weight of 541.69 g/mol. Its IUPAC name is 2-aminoethyl-bis[[5-(1H-indazol-4-yl)-1H-pyrazol-4-yl]methyl]-methylazanium;N'-methylethane-1,2-diamine.
| Compound Name | 2-aminoethyl-bis[[5-(1H-indazol-4-yl)-1H-pyrazol-4-yl]methyl]-methylazanium;N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 90463218 |
| Molecular Formula | C28H37N12+ |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | 2-aminoethyl-bis[[5-(1H-indazol-4-yl)-1H-pyrazol-4-yl]methyl]-methylazanium;N'-methylethane-1,2-diamine |
| SMILES | CNCCN.C[N+](CCN)(Cc1cn[nH]c1-c1cccc2[nH]ncc12)Cc1cn[nH]c1-c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C25H27N10.C3H10N2/c1-35(9-8-26,14-16-10-27-33-24(16)18-4-2-6-22-20(18)12-29-31-22)15-17-11-28-34-25(17)19-5-3-7-23-21(19)13-30-32-23;1-5-3-2-4/h2-7,10-13H,8-9,14-15,26H2,1H3,(H,27,33)(H,28,34)(H,29,31)(H,30,32);5H,2-4H2,1H3/q+1; |
| InChIKey | MNJYKCNRQPKMGZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 178.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|