C15H22O3 — CID 90463746
1-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-dioxolan-2-yl]pent-4-en-2-ol (PubChem CID 90463746) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-dioxolan-2-yl]pent-4-en-2-ol.
| Compound Name | 1-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-dioxolan-2-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 90463746 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-dioxolan-2-yl]pent-4-en-2-ol |
| SMILES | C=C/C=C(\C=C/C)C1(CC(O)CC=C)OCCO1 |
| InChI | InChI=1S/C15H22O3/c1-4-7-13(8-5-2)15(17-10-11-18-15)12-14(16)9-6-3/h4-8,14,16H,1,3,9-12H2,2H3/b8-5-,13-7+ |
| InChIKey | QIMQSVYIUIKYHX-AXBOXZAGSA-N |
| XLogP | 2.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|