C18H26O3 — CID 90463747
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-(2-prop-2-enoxypent-4-enyl)-1,3-dioxolane (PubChem CID 90463747) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-(2-prop-2-enoxypent-4-enyl)-1,3-dioxolane.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-(2-prop-2-enoxypent-4-enyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 90463747 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-(2-prop-2-enoxypent-4-enyl)-1,3-dioxolane |
| SMILES | C=C/C=C(\C=C/C)C1(CC(CC=C)OCC=C)OCCO1 |
| InChI | InChI=1S/C18H26O3/c1-5-9-16(10-6-2)18(20-13-14-21-18)15-17(11-7-3)19-12-8-4/h5-10,17H,1,3-4,11-15H2,2H3/b10-6-,16-9+ |
| InChIKey | NFCPIGYYJJVFTD-GQAHHDQSSA-N |
| XLogP | 3.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|