About (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one
(2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one (PubChem CID 90463771) has the molecular formula C5H8ClNO3
and a molecular weight of 165.58 g/mol. Its IUPAC name is (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one |
| PubChem CID | 90463771 |
| Molecular Formula | C5H8ClNO3 |
| Molecular Weight | 165.58 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one |
| SMILES | C[C@@H](O)[C@@H]1N[C@@H](Cl)OC1=O |
| InChI | InChI=1S/C5H8ClNO3/c1-2(8)3-4(9)10-5(6)7-3/h2-3,5,7-8H,1H3/t2-,3+,5-/m1/s1 |
| InChIKey | IYXHRTLOVMIOOF-HFDJDUASSA-N |
| XLogP | -0.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.58 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one?
The IUPAC name of (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one (CID 90463771) is (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one.
What is the SMILES notation for (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one?
The canonical SMILES for (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one is C[C@@H](O)[C@@H]1N[C@@H](Cl)OC1=O.
What is the InChIKey of (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one?
The InChIKey is IYXHRTLOVMIOOF-HFDJDUASSA-N. The full InChI is InChI=1S/C5H8ClNO3/c1-2(8)3-4(9)10-5(6)7-3/h2-3,5,7-8H,1H3/t2-,3+,5-/m1/s1.
What are the key properties of (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one?
(2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one has a molecular weight of 165.58 g/mol, XLogP of -0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-2-chloro-4-[(1R)-1-hydroxyethyl]-1,3-oxazolidin-5-one is sourced from PubChem (CID 90463771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).