About (2R)-2-chloro-1,3-oxazolidin-5-one
(2R)-2-chloro-1,3-oxazolidin-5-one (PubChem CID 90463792) has the molecular formula C3H4ClNO2
and a molecular weight of 121.52 g/mol. Its IUPAC name is (2R)-2-chloro-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | (2R)-2-chloro-1,3-oxazolidin-5-one |
| PubChem CID | 90463792 |
| Molecular Formula | C3H4ClNO2 |
| Molecular Weight | 121.52 g/mol |
| Exact Mass | 120.99 |
| IUPAC Name | (2R)-2-chloro-1,3-oxazolidin-5-one |
| SMILES | O=C1CN[C@@H](Cl)O1 |
| InChI | InChI=1S/C3H4ClNO2/c4-3-5-1-2(6)7-3/h3,5H,1H2/t3-/m1/s1 |
| InChIKey | XRUDNAPYXCYGLB-GSVOUGTGSA-N |
| XLogP | -0.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.52 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-chloro-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-chloro-1,3-oxazolidin-5-one?
The IUPAC name of (2R)-2-chloro-1,3-oxazolidin-5-one (CID 90463792) is (2R)-2-chloro-1,3-oxazolidin-5-one.
What is the SMILES notation for (2R)-2-chloro-1,3-oxazolidin-5-one?
The canonical SMILES for (2R)-2-chloro-1,3-oxazolidin-5-one is O=C1CN[C@@H](Cl)O1.
What is the InChIKey of (2R)-2-chloro-1,3-oxazolidin-5-one?
The InChIKey is XRUDNAPYXCYGLB-GSVOUGTGSA-N. The full InChI is InChI=1S/C3H4ClNO2/c4-3-5-1-2(6)7-3/h3,5H,1H2/t3-/m1/s1.
What are the key properties of (2R)-2-chloro-1,3-oxazolidin-5-one?
(2R)-2-chloro-1,3-oxazolidin-5-one has a molecular weight of 121.52 g/mol, XLogP of -0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-chloro-1,3-oxazolidin-5-one is sourced from PubChem (CID 90463792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).