About 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone
1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone (PubChem CID 90463958) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone |
| PubChem CID | 90463958 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone |
| SMILES | CC(=O)N1CCC2(CNc3ccc(S)cc32)C1 |
| InChI | InChI=1S/C13H16N2OS/c1-9(16)15-5-4-13(8-15)7-14-12-3-2-10(17)6-11(12)13/h2-3,6,14,17H,4-5,7-8H2,1H3 |
| InChIKey | PCXWSIVKJQKDRZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone?
The IUPAC name of 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone (CID 90463958) is 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone.
What is the SMILES notation for 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone?
The canonical SMILES for 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone is CC(=O)N1CCC2(CNc3ccc(S)cc32)C1.
What is the InChIKey of 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone?
The InChIKey is PCXWSIVKJQKDRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c1-9(16)15-5-4-13(8-15)7-14-12-3-2-10(17)6-11(12)13/h2-3,6,14,17H,4-5,7-8H2,1H3.
What are the key properties of 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone?
1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone has a molecular weight of 248.35 g/mol, XLogP of 1.89, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-sulfanylspiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-yl)ethanone is sourced from PubChem (CID 90463958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).