About 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone
2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone (PubChem CID 90463977) has the molecular formula C14H18ClN3O
and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone.
Molecular Properties
| Compound Name | 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone |
| PubChem CID | 90463977 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone |
| SMILES | CN1C[C@]2(CCN(C(=O)CN)C2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H18ClN3O/c1-17-8-14(4-5-18(9-14)13(19)7-16)11-6-10(15)2-3-12(11)17/h2-3,6H,4-5,7-9,16H2,1H3/t14-/m0/s1 |
| InChIKey | ZKCSYDGSXKUGDN-AWEZNQCLSA-N |
| XLogP | 1.22 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone?
The IUPAC name of 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone (CID 90463977) is 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone.
What is the SMILES notation for 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone?
The canonical SMILES for 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone is CN1C[C@]2(CCN(C(=O)CN)C2)c2cc(Cl)ccc21.
What is the InChIKey of 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone?
The InChIKey is ZKCSYDGSXKUGDN-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H18ClN3O/c1-17-8-14(4-5-18(9-14)13(19)7-16)11-6-10(15)2-3-12(11)17/h2-3,6H,4-5,7-9,16H2,1H3/t14-/m0/s1.
What are the key properties of 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone?
2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone has a molecular weight of 279.77 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[(3S)-5-chloro-1-methylspiro[2H-indole-3,3'-pyrrolidine]-1'-yl]ethanone is sourced from PubChem (CID 90463977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).