About ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate
ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate (PubChem CID 90464047) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate.
Molecular Properties
| Compound Name | ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate |
| PubChem CID | 90464047 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate |
| SMILES | C=C/C=C(\C=C(/COCCC)OC)CC(=O)OCC |
| InChI | InChI=1S/C15H24O4/c1-5-8-13(11-15(16)19-7-3)10-14(17-4)12-18-9-6-2/h5,8,10H,1,6-7,9,11-12H2,2-4H3/b13-8+,14-10+ |
| InChIKey | JGVRJFAQZGLHMW-WCKMZMOMSA-N |
| XLogP | 3.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate?
The IUPAC name of ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate (CID 90464047) is ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate.
What is the SMILES notation for ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate?
The canonical SMILES for ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate is C=C/C=C(\C=C(/COCCC)OC)CC(=O)OCC.
What is the InChIKey of ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate?
The InChIKey is JGVRJFAQZGLHMW-WCKMZMOMSA-N. The full InChI is InChI=1S/C15H24O4/c1-5-8-13(11-15(16)19-7-3)10-14(17-4)12-18-9-6-2/h5,8,10H,1,6-7,9,11-12H2,2-4H3/b13-8+,14-10+.
What are the key properties of ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate?
ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate has a molecular weight of 268.35 g/mol, XLogP of 3.01, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3Z)-3-[(E)-2-methoxy-3-propoxyprop-1-enyl]hexa-3,5-dienoate is sourced from PubChem (CID 90464047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).