About 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide
6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 90464241) has the molecular formula C8H8FN3O
and a molecular weight of 181.17 g/mol. Its IUPAC name is 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide |
| PubChem CID | 90464241 |
| Molecular Formula | C8H8FN3O |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | NC(=O)C1=CN2C=C(F)C=CC2N1 |
| InChI | InChI=1S/C8H8FN3O/c9-5-1-2-7-11-6(8(10)13)4-12(7)3-5/h1-4,7,11H,(H2,10,13) |
| InChIKey | GDWBZBBNHHVJRY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide?
The IUPAC name of 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide (CID 90464241) is 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide.
What is the SMILES notation for 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide?
The canonical SMILES for 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide is NC(=O)C1=CN2C=C(F)C=CC2N1.
What is the InChIKey of 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide?
The InChIKey is GDWBZBBNHHVJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3O/c9-5-1-2-7-11-6(8(10)13)4-12(7)3-5/h1-4,7,11H,(H2,10,13).
What are the key properties of 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide?
6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide has a molecular weight of 181.17 g/mol, XLogP of -0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,8a-dihydroimidazo[1,2-a]pyridine-2-carboxamide is sourced from PubChem (CID 90464241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).