About 1-aminopropyl methoxymethyl carbonate
1-aminopropyl methoxymethyl carbonate (PubChem CID 90464297) has the molecular formula C6H13NO4
and a molecular weight of 163.17 g/mol. Its IUPAC name is 1-aminopropyl methoxymethyl carbonate.
Molecular Properties
| Compound Name | 1-aminopropyl methoxymethyl carbonate |
| PubChem CID | 90464297 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 1-aminopropyl methoxymethyl carbonate |
| SMILES | CCC(N)OC(=O)OCOC |
| InChI | InChI=1S/C6H13NO4/c1-3-5(7)11-6(8)10-4-9-2/h5H,3-4,7H2,1-2H3 |
| InChIKey | PKUXADVUEKNNIQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropyl methoxymethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropyl methoxymethyl carbonate?
The IUPAC name of 1-aminopropyl methoxymethyl carbonate (CID 90464297) is 1-aminopropyl methoxymethyl carbonate.
What is the SMILES notation for 1-aminopropyl methoxymethyl carbonate?
The canonical SMILES for 1-aminopropyl methoxymethyl carbonate is CCC(N)OC(=O)OCOC.
What is the InChIKey of 1-aminopropyl methoxymethyl carbonate?
The InChIKey is PKUXADVUEKNNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO4/c1-3-5(7)11-6(8)10-4-9-2/h5H,3-4,7H2,1-2H3.
What are the key properties of 1-aminopropyl methoxymethyl carbonate?
1-aminopropyl methoxymethyl carbonate has a molecular weight of 163.17 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropyl methoxymethyl carbonate is sourced from PubChem (CID 90464297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).