C12H20BN3O2 — CID 90464808
[(2R)-1-[(1R,2S,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbonyl]pyrrolidin-2-yl]boronamidic acid (PubChem CID 90464808) has the molecular formula C12H20BN3O2 and a molecular weight of 249.12 g/mol. Its IUPAC name is [(2R)-1-[(1R,2S,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbonyl]pyrrolidin-2-yl]boronamidic acid.
| Compound Name | [(2R)-1-[(1R,2S,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbonyl]pyrrolidin-2-yl]boronamidic acid |
|---|---|
| PubChem CID | 90464808 |
| Molecular Formula | C12H20BN3O2 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | [(2R)-1-[(1R,2S,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbonyl]pyrrolidin-2-yl]boronamidic acid |
| SMILES | NB(O)[C@@H]1CCCN1C(=O)[C@@H]1[C@H](N)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H20BN3O2/c14-11-8-4-3-7(6-8)10(11)12(17)16-5-1-2-9(16)13(15)18/h3-4,7-11,18H,1-2,5-6,14-15H2/t7-,8+,9-,10-,11+/m0/s1 |
| InChIKey | PXLMILXUNWDVKK-HPENLJRUSA-N |
| XLogP | -0.89 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|