C19H18ClFN4O2 — CID 90465334
N-[4-[1-(2-chloroethyl)-3-(4-fluorophenyl)pyrazol-4-yl]-2-pyridinyl]-2-methoxyacetamide (PubChem CID 90465334) has the molecular formula C19H18ClFN4O2 and a molecular weight of 388.83 g/mol. Its IUPAC name is N-[4-[1-(2-chloroethyl)-3-(4-fluorophenyl)pyrazol-4-yl]-2-pyridinyl]-2-methoxyacetamide.
| Compound Name | N-[4-[1-(2-chloroethyl)-3-(4-fluorophenyl)pyrazol-4-yl]-2-pyridinyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 90465334 |
| Molecular Formula | C19H18ClFN4O2 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[4-[1-(2-chloroethyl)-3-(4-fluorophenyl)pyrazol-4-yl]-2-pyridinyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(-c2cn(CCCl)nc2-c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C19H18ClFN4O2/c1-27-12-18(26)23-17-10-14(6-8-22-17)16-11-25(9-7-20)24-19(16)13-2-4-15(21)5-3-13/h2-6,8,10-11H,7,9,12H2,1H3,(H,22,23,26) |
| InChIKey | DOPFFZJPXHQQLO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|