C15H6F10 — CID 90465462
1-[2-(3,5-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3,5-difluorobenzene (PubChem CID 90465462) has the molecular formula C15H6F10 and a molecular weight of 376.19 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3,5-difluorobenzene.
| Compound Name | 1-[2-(3,5-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 90465462 |
| Molecular Formula | C15H6F10 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(C(c2cc(F)cc(F)c2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H6F10/c16-9-1-7(2-10(17)5-9)13(14(20,21)22,15(23,24)25)8-3-11(18)6-12(19)4-8/h1-6H |
| InChIKey | CXTLTQZTHBXGQO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |