C27H30ClN5O5S — CID 90465604
4-[3-(3-chlorophenyl)-7-methoxy-2,4-dioxopyrimido[5,4-c]quinolin-1-yl]-N,N-diethylpiperidine-1-sulfonamide (PubChem CID 90465604) has the molecular formula C27H30ClN5O5S and a molecular weight of 572.09 g/mol. Its IUPAC name is 4-[3-(3-chlorophenyl)-7-methoxy-2,4-dioxopyrimido[5,4-c]quinolin-1-yl]-N,N-diethylpiperidine-1-sulfonamide.
| Compound Name | 4-[3-(3-chlorophenyl)-7-methoxy-2,4-dioxopyrimido[5,4-c]quinolin-1-yl]-N,N-diethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 90465604 |
| Molecular Formula | C27H30ClN5O5S |
| Molecular Weight | 572.09 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 4-[3-(3-chlorophenyl)-7-methoxy-2,4-dioxopyrimido[5,4-c]quinolin-1-yl]-N,N-diethylpiperidine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCC(n2c(=O)n(-c3cccc(Cl)c3)c(=O)c3cnc4c(OC)cccc4c32)CC1 |
| InChI | InChI=1S/C27H30ClN5O5S/c1-4-30(5-2)39(36,37)31-14-12-19(13-15-31)32-25-21-10-7-11-23(38-3)24(21)29-17-22(25)26(34)33(27(32)35)20-9-6-8-18(28)16-20/h6-11,16-17,19H,4-5,12-15H2,1-3H3 |
| InChIKey | UEECFWKJGWDDCW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.09 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|