C23H27FO4 — CID 90465692
[4-[(5-fluoro-2,2-dimethyl-3H-1-benzofuran-7-yl)methoxy]-2,3,5-trimethylphenyl] propanoate (PubChem CID 90465692) has the molecular formula C23H27FO4 and a molecular weight of 386.46 g/mol. Its IUPAC name is [4-[(5-fluoro-2,2-dimethyl-3H-1-benzofuran-7-yl)methoxy]-2,3,5-trimethylphenyl] propanoate.
| Compound Name | [4-[(5-fluoro-2,2-dimethyl-3H-1-benzofuran-7-yl)methoxy]-2,3,5-trimethylphenyl] propanoate |
|---|---|
| PubChem CID | 90465692 |
| Molecular Formula | C23H27FO4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [4-[(5-fluoro-2,2-dimethyl-3H-1-benzofuran-7-yl)methoxy]-2,3,5-trimethylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(C)c(OCc2cc(F)cc3c2OC(C)(C)C3)c(C)c1C |
| InChI | InChI=1S/C23H27FO4/c1-7-20(25)27-19-8-13(2)21(15(4)14(19)3)26-12-17-10-18(24)9-16-11-23(5,6)28-22(16)17/h8-10H,7,11-12H2,1-6H3 |
| InChIKey | IWMSRABICYBJIL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|