C24H27F3N2O2S — CID 90465763
2-methoxy-6-methyl-N-(6-phenyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-yl)-3-sulfanyl-4-(trifluoromethyl)benzamide (PubChem CID 90465763) has the molecular formula C24H27F3N2O2S and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-methoxy-6-methyl-N-(6-phenyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-yl)-3-sulfanyl-4-(trifluoromethyl)benzamide.
| Compound Name | 2-methoxy-6-methyl-N-(6-phenyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-yl)-3-sulfanyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90465763 |
| Molecular Formula | C24H27F3N2O2S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-methoxy-6-methyl-N-(6-phenyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-yl)-3-sulfanyl-4-(trifluoromethyl)benzamide |
| SMILES | COc1c(S)c(C(F)(F)F)cc(C)c1C(=O)NC1(c2ccccc2)CCC2CCCN2C1 |
| InChI | InChI=1S/C24H27F3N2O2S/c1-15-13-18(24(25,26)27)21(32)20(31-2)19(15)22(30)28-23(16-7-4-3-5-8-16)11-10-17-9-6-12-29(17)14-23/h3-5,7-8,13,17,32H,6,9-12,14H2,1-2H3,(H,28,30) |
| InChIKey | HBMVTPUMMMDEEQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|