C21H19N3O3 — CID 90465849
7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-phenyl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene (PubChem CID 90465849) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-phenyl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-phenyl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene |
|---|---|
| PubChem CID | 90465849 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-phenyl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene |
| SMILES | COc1nn2c3c(c(-c4c(C)noc4C)ccc13)OCC2c1ccccc1 |
| InChI | InChI=1S/C21H19N3O3/c1-12-18(13(2)27-23-12)15-9-10-16-19-20(15)26-11-17(14-7-5-4-6-8-14)24(19)22-21(16)25-3/h4-10,17H,11H2,1-3H3 |
| InChIKey | IFBJXLKXSMLVQP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |