C22H22BrN3O6 — CID 90465904
4-[4-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)butanoylamino]-N-hydroxybenzamide (PubChem CID 90465904) has the molecular formula C22H22BrN3O6 and a molecular weight of 504.34 g/mol. Its IUPAC name is 4-[4-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)butanoylamino]-N-hydroxybenzamide.
| Compound Name | 4-[4-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)butanoylamino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 90465904 |
| Molecular Formula | C22H22BrN3O6 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 4-[4-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)butanoylamino]-N-hydroxybenzamide |
| SMILES | O=C(CCCN1C(=O)C2(OCCCO2)c2cc(Br)ccc21)Nc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C22H22BrN3O6/c23-15-6-9-18-17(13-15)22(31-11-2-12-32-22)21(29)26(18)10-1-3-19(27)24-16-7-4-14(5-8-16)20(28)25-30/h4-9,13,30H,1-3,10-12H2,(H,24,27)(H,25,28) |
| InChIKey | VIKJKACGIYWQLK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|