C22H27FN4O4 — CID 90465984
(2,5-dioxopyrrolidin-1-yl) 2-[(4-fluoro-2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 90465984) has the molecular formula C22H27FN4O4 and a molecular weight of 430.48 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(4-fluoro-2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(4-fluoro-2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90465984 |
| Molecular Formula | C22H27FN4O4 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(4-fluoro-2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)N1CC2CN(Cc3ccc(F)cc3N3CCCC3)CC2C1 |
| InChI | InChI=1S/C22H27FN4O4/c23-18-4-3-15(19(9-18)25-7-1-2-8-25)10-24-11-16-13-26(14-17(16)12-24)22(30)31-27-20(28)5-6-21(27)29/h3-4,9,16-17H,1-2,5-8,10-14H2 |
| InChIKey | XTJHVWYAYOMXNW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|