C19H16N4O3 — CID 90465996
7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-one (PubChem CID 90465996) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-one.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-one |
|---|---|
| PubChem CID | 90465996 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-one |
| SMILES | Cc1noc(C)c1-c1ccc2c(=O)[nH]n3c2c1OCC3c1ccccn1 |
| InChI | InChI=1S/C19H16N4O3/c1-10-16(11(2)26-22-10)12-6-7-13-17-18(12)25-9-15(23(17)21-19(13)24)14-5-3-4-8-20-14/h3-8,15H,9H2,1-2H3,(H,21,24) |
| InChIKey | AKYWXIRMBILVAU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |