C20H18N4O3 — CID 90465998
7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-pyridin-2-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene (PubChem CID 90465998) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-pyridin-2-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-pyridin-2-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene |
|---|---|
| PubChem CID | 90465998 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-pyridin-2-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene |
| SMILES | COc1nn2c3c(c(-c4c(C)noc4C)ccc13)OCC2c1ccccn1 |
| InChI | InChI=1S/C20H18N4O3/c1-11-17(12(2)27-23-11)13-7-8-14-18-19(13)26-10-16(15-6-4-5-9-21-15)24(18)22-20(14)25-3/h4-9,16H,10H2,1-3H3 |
| InChIKey | HWLZAFCGYYKINC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |