About 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate
3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate (PubChem CID 90466051) has the molecular formula C11H22N2O4
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate.
Molecular Properties
| Compound Name | 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate |
| PubChem CID | 90466051 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate |
| SMILES | CC(=O)[O-].OCC(O)C[N+]12CCN(CC1)CC2 |
| InChI | InChI=1S/C9H19N2O2.C2H4O2/c12-8-9(13)7-11-4-1-10(2-5-11)3-6-11;1-2(3)4/h9,12-13H,1-8H2;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | IINALKKYBBMICU-UHFFFAOYSA-M |
| XLogP | -2.76 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate?
The IUPAC name of 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate (CID 90466051) is 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate.
What is the SMILES notation for 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate?
The canonical SMILES for 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate is CC(=O)[O-].OCC(O)C[N+]12CCN(CC1)CC2.
What is the InChIKey of 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate?
The InChIKey is IINALKKYBBMICU-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H19N2O2.C2H4O2/c12-8-9(13)7-11-4-1-10(2-5-11)3-6-11;1-2(3)4/h9,12-13H,1-8H2;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate?
3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate has a molecular weight of 246.31 g/mol, XLogP of -2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)propane-1,2-diol acetate is sourced from PubChem (CID 90466051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).